C24H30N4O8S — CID 88724655
2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-[[(2R)-2-[formamido(formyl)amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88724655) has the molecular formula C24H30N4O8S and a molecular weight of 534.59 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-[[(2R)-2-[formamido(formyl)amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-[[(2R)-2-[formamido(formyl)amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88724655 |
| Molecular Formula | C24H30N4O8S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6S)-6-[[(2R)-2-[formamido(formyl)amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)[C@H](NC(=O)[C@@H](c3ccccc3)N(C=O)NC=O)[C@H]2SC1(C)C |
| InChI | InChI=1S/C24H30N4O8S/c1-23(2,3)22(34)36-13-35-21(33)17-24(4,5)37-20-15(19(32)28(17)20)26-18(31)16(27(12-30)25-11-29)14-9-7-6-8-10-14/h6-12,15-17,20H,13H2,1-5H3,(H,25,29)(H,26,31)/t15-,16+,17-,20+/m0/s1 |
| InChIKey | BGEOKIFTDVAQAQ-PFRQMTDMSA-N |
| XLogP | 0.48 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|