C18H19F3N8O7S3 — CID 22795965
(6S,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 22795965) has the molecular formula C18H19F3N8O7S3 and a molecular weight of 612.59 g/mol. Its IUPAC name is (6S,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (6S,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22795965 |
| Molecular Formula | C18H19F3N8O7S3 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.05 |
| IUPAC Name | (6S,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@]1(NC(=O)Cc2csc(N)n2)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H18N8O5S3.C2HF3O2/c1-23-15(20-21-22-23)32-5-7-4-30-13-16(29-2,12(28)24(13)10(7)11(26)27)19-9(25)3-8-6-31-14(17)18-8;3-2(4,5)1(6)7/h6,13H,3-5H2,1-2H3,(H2,17,18)(H,19,25)(H,26,27);(H,6,7)/t13-,16-;/m0./s1 |
| InChIKey | JXKMBBVRKHKTJX-LINSIKMZSA-N |
| XLogP | -0.07 |
| TPSA | 215.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|