C23H32N6O6S — CID 22796338
(3S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-[[(2R)-1-amino-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 22796338) has the molecular formula C23H32N6O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-[[(2R)-1-amino-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-[[(2R)-1-amino-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22796338 |
| Molecular Formula | C23H32N6O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-[[(2R)-1-amino-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C)C(N)=O |
| InChI | InChI=1S/C23H32N6O6S/c1-12(20(25)32)27-23(35)18(10-19(30)31)29-22(34)17(7-8-36-2)28-21(33)15(24)9-13-11-26-16-6-4-3-5-14(13)16/h3-6,11-12,15,17-18,26H,7-10,24H2,1-2H3,(H2,25,32)(H,27,35)(H,28,33)(H,29,34)(H,30,31)/t12-,15+,17+,18+/m1/s1 |
| InChIKey | YUXPDGDKTJPTES-VFAJRCTISA-N |
| XLogP | -0.77 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |