C12H16N3NaO6S — CID 22796523
sodium (2S,5R,6R)-3,3-dimethyl-6-(2-nitrobutanoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22796523) has the molecular formula C12H16N3NaO6S and a molecular weight of 353.33 g/mol. Its IUPAC name is sodium (2S,5R,6R)-3,3-dimethyl-6-(2-nitrobutanoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-3,3-dimethyl-6-(2-nitrobutanoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22796523 |
| Molecular Formula | C12H16N3NaO6S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | sodium (2S,5R,6R)-3,3-dimethyl-6-(2-nitrobutanoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCC(C(=O)N[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)[O-])[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C12H17N3O6S.Na/c1-4-5(15(20)21)8(16)13-6-9(17)14-7(11(18)19)12(2,3)22-10(6)14;/h5-7,10H,4H2,1-3H3,(H,13,16)(H,18,19);/q;+1/p-1/t5?,6-,7+,10-;/m1./s1 |
| InChIKey | DRSUOYCDNIDIPA-HJOIMMPGSA-M |
| XLogP | -4.66 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|