C15H17N2NaO6S3 — CID 23675675
sodium 6-[[2-(1,3-dithiolan-2-ylidene)-3-methoxy-3-oxopropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23675675) has the molecular formula C15H17N2NaO6S3 and a molecular weight of 440.50 g/mol. Its IUPAC name is sodium 6-[[2-(1,3-dithiolan-2-ylidene)-3-methoxy-3-oxopropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium 6-[[2-(1,3-dithiolan-2-ylidene)-3-methoxy-3-oxopropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23675675 |
| Molecular Formula | C15H17N2NaO6S3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | sodium 6-[[2-(1,3-dithiolan-2-ylidene)-3-methoxy-3-oxopropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)C(C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-])=C1SCCS1.[Na+] |
| InChI | InChI=1S/C15H18N2O6S3.Na/c1-15(2)8(12(20)21)17-10(19)7(11(17)26-15)16-9(18)6(13(22)23-3)14-24-4-5-25-14;/h7-8,11H,4-5H2,1-3H3,(H,16,18)(H,20,21);/q;+1/p-1 |
| InChIKey | PROXUPPGDGXDST-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|