C17H22N3NaO5S — CID 23682078
sodium (2S,5R,6R)-6-[[(2Z)-2-(cyclohexen-1-yl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23682078) has the molecular formula C17H22N3NaO5S and a molecular weight of 403.44 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[[(2Z)-2-(cyclohexen-1-yl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[[(2Z)-2-(cyclohexen-1-yl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23682078 |
| Molecular Formula | C17H22N3NaO5S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | sodium (2S,5R,6R)-6-[[(2Z)-2-(cyclohexen-1-yl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)[O-])C1=CCCCC1.[Na+] |
| InChI | InChI=1S/C17H23N3O5S.Na/c1-17(2)12(16(23)24)20-14(22)11(15(20)26-17)18-13(21)10(19-25-3)9-7-5-4-6-8-9;/h7,11-12,15H,4-6,8H2,1-3H3,(H,18,21)(H,23,24);/q;+1/p-1/b19-10-;/t11-,12+,15-;/m1./s1 |
| InChIKey | PKYSIAQBFWORCJ-BCTBUCDGSA-M |
| XLogP | -3.21 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|