C21H23N5O10S2 — CID 22796654
(6S,7R)-3-(carbamoyloxymethyl)-7-[[5-carboxy-5-[(2-nitrophenyl)sulfanylamino]pentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22796654) has the molecular formula C21H23N5O10S2 and a molecular weight of 569.57 g/mol. Its IUPAC name is (6S,7R)-3-(carbamoyloxymethyl)-7-[[5-carboxy-5-[(2-nitrophenyl)sulfanylamino]pentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(carbamoyloxymethyl)-7-[[5-carboxy-5-[(2-nitrophenyl)sulfanylamino]pentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22796654 |
| Molecular Formula | C21H23N5O10S2 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | (6S,7R)-3-(carbamoyloxymethyl)-7-[[5-carboxy-5-[(2-nitrophenyl)sulfanylamino]pentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)CCCC(NSc3ccccc3[N+](=O)[O-])C(=O)O)[C@@H]2SC1 |
| InChI | InChI=1S/C21H23N5O10S2/c22-21(33)36-8-10-9-37-18-15(17(28)25(18)16(10)20(31)32)23-14(27)7-3-4-11(19(29)30)24-38-13-6-2-1-5-12(13)26(34)35/h1-2,5-6,11,15,18,24H,3-4,7-9H2,(H2,22,33)(H,23,27)(H,29,30)(H,31,32)/t11?,15-,18+/m1/s1 |
| InChIKey | GSPNZMPROGGRDJ-HLSDDEKHSA-N |
| XLogP | 0.65 |
| TPSA | 231.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|