C14H19N3O8S — CID 59034659
3-(carbamoyloxymethyl)-7-[4-(hydroxymethoxy)butanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 59034659) has the molecular formula C14H19N3O8S and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-(carbamoyloxymethyl)-7-[4-(hydroxymethoxy)butanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(carbamoyloxymethyl)-7-[4-(hydroxymethoxy)butanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 59034659 |
| Molecular Formula | C14H19N3O8S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-(carbamoyloxymethyl)-7-[4-(hydroxymethoxy)butanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)CCCOCO)C2SC1 |
| InChI | InChI=1S/C14H19N3O8S/c15-14(23)25-4-7-5-26-12-9(11(20)17(12)10(7)13(21)22)16-8(19)2-1-3-24-6-18/h9,12,18H,1-6H2,(H2,15,23)(H,16,19)(H,21,22) |
| InChIKey | HCHFOULJCIPNLP-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|