C26H28N2O — CID 22797160
cyclohex-3-en-1-yl-[(2R,7R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-8,10,12(21),15,17,19-hexaen-5-yl]methanone (PubChem CID 22797160) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-[(2R,7R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-8,10,12(21),15,17,19-hexaen-5-yl]methanone.
| Compound Name | cyclohex-3-en-1-yl-[(2R,7R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-8,10,12(21),15,17,19-hexaen-5-yl]methanone |
|---|---|
| PubChem CID | 22797160 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | cyclohex-3-en-1-yl-[(2R,7R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-8,10,12(21),15,17,19-hexaen-5-yl]methanone |
| SMILES | O=C(C1CC=CCC1)N1CC[C@@H]2[C@@H](C1)c1cccc3c1N2c1ccccc1CC3 |
| InChI | InChI=1S/C26H28N2O/c29-26(20-8-2-1-3-9-20)27-16-15-24-22(17-27)21-11-6-10-19-14-13-18-7-4-5-12-23(18)28(24)25(19)21/h1-2,4-7,10-12,20,22,24H,3,8-9,13-17H2/t20?,22-,24+/m0/s1 |
| InChIKey | BDLUPLOQORWUTJ-GBGBMPJPSA-N |
| XLogP | 4.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|