C18H24I3N3O8 — CID 22797296
5-acetamido-2,4,6-triiodo-1-N,3-N-dimethyl-3-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]benzene-1,3-dicarboxamide (PubChem CID 22797296) has the molecular formula C18H24I3N3O8 and a molecular weight of 791.11 g/mol. Its IUPAC name is 5-acetamido-2,4,6-triiodo-1-N,3-N-dimethyl-3-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-acetamido-2,4,6-triiodo-1-N,3-N-dimethyl-3-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 22797296 |
| Molecular Formula | C18H24I3N3O8 |
| Molecular Weight | 791.11 g/mol |
| Exact Mass | 790.87 |
| IUPAC Name | 5-acetamido-2,4,6-triiodo-1-N,3-N-dimethyl-3-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]benzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1I |
| InChI | InChI=1S/C18H24I3N3O8/c1-6(26)23-14-12(20)9(17(31)22-2)11(19)10(13(14)21)18(32)24(3)4-7(27)15(29)16(30)8(28)5-25/h7-8,15-16,25,27-30H,4-5H2,1-3H3,(H,22,31)(H,23,26)/t7-,8+,15+,16+/m0/s1 |
| InChIKey | DVDIUFCTSCFUQN-POVIXMMNSA-N |
| XLogP | -0.67 |
| TPSA | 179.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.11 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|