C13H14I3N3O6 — CID 87595486
2,4,6-triiodo-3-N-methyl-5-(2,3,4-trihydroxybutanoylamino)benzene-1,3-dicarboxamide (PubChem CID 87595486) has the molecular formula C13H14I3N3O6 and a molecular weight of 688.98 g/mol. Its IUPAC name is 2,4,6-triiodo-3-N-methyl-5-(2,3,4-trihydroxybutanoylamino)benzene-1,3-dicarboxamide.
| Compound Name | 2,4,6-triiodo-3-N-methyl-5-(2,3,4-trihydroxybutanoylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87595486 |
| Molecular Formula | C13H14I3N3O6 |
| Molecular Weight | 688.98 g/mol |
| Exact Mass | 688.80 |
| IUPAC Name | 2,4,6-triiodo-3-N-methyl-5-(2,3,4-trihydroxybutanoylamino)benzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1c(I)c(NC(=O)C(O)C(O)CO)c(I)c(C(N)=O)c1I |
| InChI | InChI=1S/C13H14I3N3O6/c1-18-12(24)5-6(14)4(11(17)23)7(15)9(8(5)16)19-13(25)10(22)3(21)2-20/h3,10,20-22H,2H2,1H3,(H2,17,23)(H,18,24)(H,19,25) |
| InChIKey | YCGFSKZQJXBZBJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.98 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|