C28H51NO3 — CID 22799867
1-[[7-[(1S,2S)-2-octylcyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 22799867) has the molecular formula C28H51NO3 and a molecular weight of 449.72 g/mol. Its IUPAC name is 1-[[7-[(1S,2S)-2-octylcyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[7-[(1S,2S)-2-octylcyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22799867 |
| Molecular Formula | C28H51NO3 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.39 |
| IUPAC Name | 1-[[7-[(1S,2S)-2-octylcyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(=O)NCC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C28H51NO3/c1-2-3-4-5-6-10-16-24-18-15-19-25(24)17-11-7-8-12-20-26(30)29-23-28(27(31)32)21-13-9-14-22-28/h24-25H,2-23H2,1H3,(H,29,30)(H,31,32)/t24-,25-/m0/s1 |
| InChIKey | DDPAGGQPGNEXQX-DQEYMECFSA-N |
| XLogP | 7.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|