C21H31BrO5 — CID 22801507
2-[(3R,5R,6R,8S,9S,10R,13S,14S)-5-bromo-3,6-dihydroxy-10,13-dimethyl-17-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 22801507) has the molecular formula C21H31BrO5 and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-[(3R,5R,6R,8S,9S,10R,13S,14S)-5-bromo-3,6-dihydroxy-10,13-dimethyl-17-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(3R,5R,6R,8S,9S,10R,13S,14S)-5-bromo-3,6-dihydroxy-10,13-dimethyl-17-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 22801507 |
| Molecular Formula | C21H31BrO5 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[(3R,5R,6R,8S,9S,10R,13S,14S)-5-bromo-3,6-dihydroxy-10,13-dimethyl-17-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H](C[C@@H](O)[C@@]4(Br)C[C@](O)(CC(=O)O)CC[C@]34C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H31BrO5/c1-18-6-5-14-12(13(18)3-4-15(18)23)9-16(24)21(22)11-20(27,10-17(25)26)8-7-19(14,21)2/h12-14,16,24,27H,3-11H2,1-2H3,(H,25,26)/t12-,13-,14-,16+,18-,19+,20+,21-/m0/s1 |
| InChIKey | VOKTUTPBFBJKGL-PVIKEKFWSA-N |
| XLogP | 3.29 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|