C18H21N3O5 — CID 22805898
(2S)-2-amino-N-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-phenylpropanamide (PubChem CID 22805898) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 22805898 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2S)-2-amino-N-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCC(O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O5/c19-17(10-13-4-2-1-3-5-13)18(23)20-11-15(22)12-26-16-8-6-14(7-9-16)21(24)25/h1-9,15,17,22H,10-12,19H2,(H,20,23)/t15?,17-/m0/s1 |
| InChIKey | JAHABLKIJXKWPU-LWKPJOBUSA-N |
| XLogP | 1.02 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|