C20H20F4N2O8 — CID 70629669
fluoro 2,2,2-trifluoroacetate;[2-hydroxy-3-(4-nitrophenoxy)propyl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 70629669) has the molecular formula C20H20F4N2O8 and a molecular weight of 492.38 g/mol. Its IUPAC name is fluoro 2,2,2-trifluoroacetate;[2-hydroxy-3-(4-nitrophenoxy)propyl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | fluoro 2,2,2-trifluoroacetate;[2-hydroxy-3-(4-nitrophenoxy)propyl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 70629669 |
| Molecular Formula | C20H20F4N2O8 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | fluoro 2,2,2-trifluoroacetate;[2-hydroxy-3-(4-nitrophenoxy)propyl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)OCC(O)COc1ccc([N+](=O)[O-])cc1.O=C(OF)C(F)(F)F |
| InChI | InChI=1S/C18H20N2O6.C2F4O2/c19-17(10-13-4-2-1-3-5-13)18(22)26-12-15(21)11-25-16-8-6-14(7-9-16)20(23)24;3-2(4,5)1(7)8-6/h1-9,15,17,21H,10-12,19H2;/t15?,17-;/m0./s1 |
| InChIKey | SBXZLIXZAMXDIR-RAOUYDSVSA-N |
| XLogP | 2.42 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|