C24H31ClO7 — CID 22805986
[2-[(7S,8R,9R,10S,11S,13S,14S,16R,17R)-9-chloro-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 22805986) has the molecular formula C24H31ClO7 and a molecular weight of 466.96 g/mol. Its IUPAC name is [2-[(7S,8R,9R,10S,11S,13S,14S,16R,17R)-9-chloro-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(7S,8R,9R,10S,11S,13S,14S,16R,17R)-9-chloro-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 22805986 |
| Molecular Formula | C24H31ClO7 |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [2-[(7S,8R,9R,10S,11S,13S,14S,16R,17R)-9-chloro-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3[C@@H](O)CC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H31ClO7/c1-12-7-16-20-17(28)9-14-8-15(27)5-6-21(14,3)23(20,25)18(29)10-22(16,4)24(12,31)19(30)11-32-13(2)26/h5-6,8,12,16-18,20,28-29,31H,7,9-11H2,1-4H3/t12-,16+,17+,18+,20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | HAGWQWGKAGYTJN-ZZNZVOATSA-N |
| XLogP | 1.71 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|