C24H32O7 — CID 70615986
[2-oxo-2-[(8S,9S,10R,13S,14S,17R)-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate (PubChem CID 70615986) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is [2-oxo-2-[(8S,9S,10R,13S,14S,17R)-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate.
| Compound Name | [2-oxo-2-[(8S,9S,10R,13S,14S,17R)-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate |
|---|---|
| PubChem CID | 70615986 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [2-oxo-2-[(8S,9S,10R,13S,14S,17R)-7,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)C(C)C[C@H]2[C@@H]3C(O)CC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C24H32O7/c1-12-7-16-20-17(27)9-14-8-15(26)5-6-22(14,3)21(20)18(28)10-23(16,4)24(12,30)19(29)11-31-13(2)25/h5-6,8,12,16-18,20-21,27-28,30H,7,9-11H2,1-4H3/t12?,16-,17?,18?,20+,21-,22-,23-,24-/m0/s1 |
| InChIKey | XGPPCVWLWJHSCW-AGAFIDRQSA-N |
| XLogP | 1.35 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |