C13H25N6O6P — CID 22806340
[(1R)-1-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]ethyl]phosphonic acid (PubChem CID 22806340) has the molecular formula C13H25N6O6P and a molecular weight of 392.35 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 22806340 |
| Molecular Formula | C13H25N6O6P |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(1R)-1-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]ethyl]phosphonic acid |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCC(=O)N1)P(=O)(O)O |
| InChI | InChI=1S/C13H25N6O6P/c1-7(26(23,24)25)17-11(21)8(3-2-6-16-13(14)15)19-12(22)9-4-5-10(20)18-9/h7-9H,2-6H2,1H3,(H,17,21)(H,18,20)(H,19,22)(H4,14,15,16)(H2,23,24,25)/t7-,8+,9+/m1/s1 |
| InChIKey | PRSOKEOMCHINOB-VGMNWLOBSA-N |
| XLogP | -2.56 |
| TPSA | 209.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|