C13H22N6O5 — CID 18605711
(2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid (PubChem CID 18605711) has the molecular formula C13H22N6O5 and a molecular weight of 342.36 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18605711 |
| Molecular Formula | C13H22N6O5 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CNC(=O)[C@@H]1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C13H22N6O5/c14-13(15)16-5-1-2-8(12(23)24)19-10(21)6-17-11(22)7-3-4-9(20)18-7/h7-8H,1-6H2,(H,17,22)(H,18,20)(H,19,21)(H,23,24)(H4,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | IWWPPYAHLDRYPH-YUMQZZPRSA-N |
| XLogP | -3.00 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|