C28H44O5 — CID 22806882
[(3S,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-(1-methoxycyclohexyl)oxy-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 22806882) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-(1-methoxycyclohexyl)oxy-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [(3S,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-(1-methoxycyclohexyl)oxy-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 22806882 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [(3S,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-(1-methoxycyclohexyl)oxy-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | COC1(O[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(COC(C)=O)[C@H]4CC[C@]23C)CCCCC1 |
| InChI | InChI=1S/C28H44O5/c1-19(29)32-18-27-16-11-21(30)17-20(27)7-8-22-23-9-10-25(26(23,2)15-12-24(22)27)33-28(31-3)13-5-4-6-14-28/h7,21-25,30H,4-6,8-18H2,1-3H3/t21-,22-,23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | MJBNHPFRDWNSNG-FAFIDUEOSA-N |
| XLogP | 5.55 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|