C3H6O3P+ — CID 22807531
hydroxy-[(2S,3R)-3-methyloxiran-2-yl]-oxophosphanium (PubChem CID 22807531) has the molecular formula C3H6O3P+ and a molecular weight of 121.05 g/mol. Its IUPAC name is hydroxy-[(2S,3R)-3-methyloxiran-2-yl]-oxophosphanium.
| Compound Name | hydroxy-[(2S,3R)-3-methyloxiran-2-yl]-oxophosphanium |
|---|---|
| PubChem CID | 22807531 |
| Molecular Formula | C3H6O3P+ |
| Molecular Weight | 121.05 g/mol |
| Exact Mass | 121.00 |
| IUPAC Name | hydroxy-[(2S,3R)-3-methyloxiran-2-yl]-oxophosphanium |
| SMILES | C[C@H]1O[C@H]1[P+](=O)O |
| InChI | InChI=1S/C3H5O3P/c1-2-3(6-2)7(4)5/h2-3H,1H3/p+1/t2-,3+/m1/s1 |
| InChIKey | KJLNTKLDNDCKBS-GBXIJSLDSA-O |
| XLogP | 0.47 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.05 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|