C7H10O3 — CID 11804851
bis[(2R,3S)-3-methyloxiran-2-yl]methanone (PubChem CID 11804851) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is bis[(2R,3S)-3-methyloxiran-2-yl]methanone.
| Compound Name | bis[(2R,3S)-3-methyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 11804851 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | bis[(2R,3S)-3-methyloxiran-2-yl]methanone |
| SMILES | C[C@@H]1O[C@H]1C(=O)[C@@H]1O[C@H]1C |
| InChI | InChI=1S/C7H10O3/c1-3-6(9-3)5(8)7-4(2)10-7/h3-4,6-7H,1-2H3/t3-,4-,6+,7+/m0/s1 |
| InChIKey | XHZRZLKQPYDVFT-VEVTUDRCSA-N |
| XLogP | 0.13 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|