C4H7O5P — CID 10487243
[(2S,3R)-3-methyloxirane-2-carbonyl]phosphonic acid (PubChem CID 10487243) has the molecular formula C4H7O5P and a molecular weight of 166.07 g/mol. Its IUPAC name is [(2S,3R)-3-methyloxirane-2-carbonyl]phosphonic acid.
| Compound Name | [(2S,3R)-3-methyloxirane-2-carbonyl]phosphonic acid |
|---|---|
| PubChem CID | 10487243 |
| Molecular Formula | C4H7O5P |
| Molecular Weight | 166.07 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | [(2S,3R)-3-methyloxirane-2-carbonyl]phosphonic acid |
| SMILES | C[C@H]1O[C@@H]1C(=O)P(=O)(O)O |
| InChI | InChI=1S/C4H7O5P/c1-2-3(9-2)4(5)10(6,7)8/h2-3H,1H3,(H2,6,7,8)/t2-,3+/m1/s1 |
| InChIKey | WWXADXJEBNSJDO-GBXIJSLDSA-N |
| XLogP | -0.52 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.07 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|