C16H27ClO7 — CID 22808056
[(2S,3R,4S,6R)-6-[(2S,3R,4S)-6-chloro-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] acetate (PubChem CID 22808056) has the molecular formula C16H27ClO7 and a molecular weight of 366.84 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-6-[(2S,3R,4S)-6-chloro-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,6R)-6-[(2S,3R,4S)-6-chloro-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 22808056 |
| Molecular Formula | C16H27ClO7 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [(2S,3R,4S,6R)-6-[(2S,3R,4S)-6-chloro-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] acetate |
| SMILES | CO[C@H]1CC(Cl)O[C@@H](C)[C@H]1O[C@@H]1C[C@H](OC)[C@H](OC(C)=O)[C@H](C)O1 |
| InChI | InChI=1S/C16H27ClO7/c1-8-16(11(19-4)6-13(17)21-8)24-14-7-12(20-5)15(9(2)22-14)23-10(3)18/h8-9,11-16H,6-7H2,1-5H3/t8-,9-,11-,12-,13?,14+,15+,16+/m0/s1 |
| InChIKey | HCOSPDNTHUAMQO-RFFSNUFKSA-N |
| XLogP | 1.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|