C14H17N3O3S — CID 22809383
2-(4-hydroxyanilino)-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]acetamide (PubChem CID 22809383) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-(4-hydroxyanilino)-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]acetamide.
| Compound Name | 2-(4-hydroxyanilino)-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]acetamide |
|---|---|
| PubChem CID | 22809383 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(4-hydroxyanilino)-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]acetamide |
| SMILES | O=C(CNc1ccc(O)cc1)NC1C(=O)N2CCCS[C@@H]12 |
| InChI | InChI=1S/C14H17N3O3S/c18-10-4-2-9(3-5-10)15-8-11(19)16-12-13(20)17-6-1-7-21-14(12)17/h2-5,12,14-15,18H,1,6-8H2,(H,16,19)/t12?,14-/m0/s1 |
| InChIKey | CMTHMAZAFBJLID-PYMCNQPYSA-N |
| XLogP | 0.59 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|