C14H16N2O3S — CID 54368837
N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide (PubChem CID 54368837) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide.
| Compound Name | N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 54368837 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N2CCCS[C@@H]12 |
| InChI | InChI=1S/C14H16N2O3S/c17-11(9-19-10-5-2-1-3-6-10)15-12-13(18)16-7-4-8-20-14(12)16/h1-3,5-6,12,14H,4,7-9H2,(H,15,17)/t12?,14-/m0/s1 |
| InChIKey | URSCQDKTPPAUPG-PYMCNQPYSA-N |
| XLogP | 0.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |