C14H15BrN2O3S — CID 54406204
N-[(3R,5S)-3-(bromomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenoxyacetamide (PubChem CID 54406204) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is N-[(3R,5S)-3-(bromomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenoxyacetamide.
| Compound Name | N-[(3R,5S)-3-(bromomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 54406204 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | N-[(3R,5S)-3-(bromomethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N2C[C@H](CBr)S[C@@H]12 |
| InChI | InChI=1S/C14H15BrN2O3S/c15-6-10-7-17-13(19)12(14(17)21-10)16-11(18)8-20-9-4-2-1-3-5-9/h1-5,10,12,14H,6-8H2,(H,16,18)/t10-,12?,14-/m0/s1 |
| InChIKey | VQVZIWRDDJOXKW-QHSVJNGKSA-N |
| XLogP | 1.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|