C27H32O7 — CID 22809889
[2-[(11S,13S,14S,16R,17S)-3,11-dihydroxy-13,16-dimethyl-17-propanoyloxy-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate (PubChem CID 22809889) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is [2-[(11S,13S,14S,16R,17S)-3,11-dihydroxy-13,16-dimethyl-17-propanoyloxy-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate.
| Compound Name | [2-[(11S,13S,14S,16R,17S)-3,11-dihydroxy-13,16-dimethyl-17-propanoyloxy-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 22809889 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | [2-[(11S,13S,14S,16R,17S)-3,11-dihydroxy-13,16-dimethyl-17-propanoyloxy-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)[C@]1(OC(=O)CC)[C@H](C)C[C@H]2c3ccc4cc(O)ccc4c3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C27H32O7/c1-5-23(31)33-14-22(30)27(34-24(32)6-2)15(3)11-20-19-9-7-16-12-17(28)8-10-18(16)25(19)21(29)13-26(20,27)4/h7-10,12,15,20-21,28-29H,5-6,11,13-14H2,1-4H3/t15-,20+,21+,26+,27-/m1/s1 |
| InChIKey | DUVOLTZJSMNNAR-SOKSLSAXSA-N |
| XLogP | 4.33 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |