C30H35FO9 — CID 22810951
[2-[(8R,9R,10S,13S,14S,16S,17S)-6-acetyloxy-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate (PubChem CID 22810951) has the molecular formula C30H35FO9 and a molecular weight of 558.60 g/mol. Its IUPAC name is [2-[(8R,9R,10S,13S,14S,16S,17S)-6-acetyloxy-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate.
| Compound Name | [2-[(8R,9R,10S,13S,14S,16S,17S)-6-acetyloxy-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 22810951 |
| Molecular Formula | C30H35FO9 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | [2-[(8R,9R,10S,13S,14S,16S,17S)-6-acetyloxy-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)[C@]1(OC(=O)CC)[C@@H](C)C[C@H]2[C@@H]3C=C(OC(C)=O)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@@]21C |
| InChI | InChI=1S/C30H35FO9/c1-7-25(36)38-15-24(35)30(40-26(37)8-2)16(3)11-19-20-13-22(39-17(4)32)21-12-18(33)9-10-27(21,5)29(20,31)23(34)14-28(19,30)6/h9-10,12-13,16,19-20H,7-8,11,14-15H2,1-6H3/t16-,19-,20-,27-,28-,29-,30+/m0/s1 |
| InChIKey | XMFNLBCQXLALSK-XVWZNNGMSA-N |
| XLogP | 3.69 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|