C31H39FO9 — CID 70582508
[2-[(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,17-di(propanoyloxy)-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate (PubChem CID 70582508) has the molecular formula C31H39FO9 and a molecular weight of 574.64 g/mol. Its IUPAC name is [2-[(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,17-di(propanoyloxy)-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate.
| Compound Name | [2-[(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,17-di(propanoyloxy)-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 70582508 |
| Molecular Formula | C31H39FO9 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | [2-[(8R,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,17-di(propanoyloxy)-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@H]2[C@@H]3C=C(OC(=O)CC)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C31H39FO9/c1-7-25(36)39-16-24(35)31(41-27(38)9-3)17(4)12-19-20-14-22(40-26(37)8-2)21-13-18(33)10-11-28(21,5)30(20,32)23(34)15-29(19,31)6/h10-11,13-14,17,19-20,23,34H,7-9,12,15-16H2,1-6H3/t17-,19+,20+,23+,28+,29+,30+,31+/m1/s1 |
| InChIKey | LWWXHVOSEYZYCJ-XNZJNDOOSA-N |
| XLogP | 3.87 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|