C32H48NO+ — CID 22811050
(3S,5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pyridin-1-ium-1-yl-1,2,3,4,5,6,7,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthren-15-one (PubChem CID 22811050) has the molecular formula C32H48NO+ and a molecular weight of 462.74 g/mol. Its IUPAC name is (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pyridin-1-ium-1-yl-1,2,3,4,5,6,7,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthren-15-one.
| Compound Name | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pyridin-1-ium-1-yl-1,2,3,4,5,6,7,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthren-15-one |
|---|---|
| PubChem CID | 22811050 |
| Molecular Formula | C32H48NO+ |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pyridin-1-ium-1-yl-1,2,3,4,5,6,7,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthren-15-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC(=O)C2=C3CC[C@H]4C[C@@H]([n+]5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H48NO/c1-22(2)10-9-11-23(3)28-21-29(34)30-26-13-12-24-20-25(33-18-7-6-8-19-33)14-16-31(24,4)27(26)15-17-32(28,30)5/h6-8,18-19,22-25,27-28H,9-17,20-21H2,1-5H3/q+1/t23-,24+,25+,27?,28-,31+,32-/m1/s1 |
| InChIKey | MQSDFKNATXTWAT-ZAAPXTOPSA-N |
| XLogP | 7.88 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|