C22H37FO4 — CID 22813297
5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid (PubChem CID 22813297) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid.
| Compound Name | 5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 22813297 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-2-methylpentanoic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@H]1[C@H]2C[C@@H](CCCC(C)C(=O)O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C22H37FO4/c1-4-5-9-19(23)20(24)11-10-17-15(3)12-21-18(17)13-16(27-21)8-6-7-14(2)22(25)26/h10-11,14-21,24H,4-9,12-13H2,1-3H3,(H,25,26)/b11-10+/t14?,15-,16-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | NYFINOVHYVWXTQ-QLQXWOPMSA-N |
| XLogP | 4.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|