C16H10BrClN2O2 — CID 2281367
N-(5-bromo-2-pyridinyl)-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 2281367) has the molecular formula C16H10BrClN2O2 and a molecular weight of 377.63 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2281367 |
| Molecular Formula | C16H10BrClN2O2 |
| Molecular Weight | 377.63 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C16H10BrClN2O2/c17-11-4-7-15(19-9-11)20-16(21)14-6-5-13(22-14)10-2-1-3-12(18)8-10/h1-9H,(H,19,20,21) |
| InChIKey | GRWLQFXKDZSRNX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |