C25H32F2O5S — CID 22815513
(8S,9R,10S,11S,13S,14S,16S,17R)-4,9-difluoro-11-hydroxy-2,10,13,16-tetramethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 22815513) has the molecular formula C25H32F2O5S and a molecular weight of 482.59 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16S,17R)-4,9-difluoro-11-hydroxy-2,10,13,16-tetramethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9R,10S,11S,13S,14S,16S,17R)-4,9-difluoro-11-hydroxy-2,10,13,16-tetramethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 22815513 |
| Molecular Formula | C25H32F2O5S |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-4,9-difluoro-11-hydroxy-2,10,13,16-tetramethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CCC(=O)O[C@]1(C(=O)S)[C@@H](C)C[C@H]2[C@@H]3CCC4=C(F)C(=O)C(C)=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H32F2O5S/c1-6-18(29)32-25(21(31)33)13(3)9-16-14-7-8-15-19(26)20(30)12(2)10-22(15,4)24(14,27)17(28)11-23(16,25)5/h10,13-14,16-17,28H,6-9,11H2,1-5H3,(H,31,33)/t13-,14-,16-,17-,22-,23-,24-,25-/m0/s1 |
| InChIKey | NMKYBLMQSSBXIM-VBZJYXAVSA-N |
| XLogP | 4.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|