C24H29ClF2O5 — CID 88761202
[(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-4,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 88761202) has the molecular formula C24H29ClF2O5 and a molecular weight of 470.94 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-4,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-4,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 88761202 |
| Molecular Formula | C24H29ClF2O5 |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-17-(2-chloroacetyl)-4,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CCC4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C24H29ClF2O5/c1-12-9-16-14-5-6-15-20(26)17(29)7-8-21(15,3)23(14,27)18(30)10-22(16,4)24(12,19(31)11-25)32-13(2)28/h7-8,12,14,16,18,30H,5-6,9-11H2,1-4H3/t12?,14-,16-,18?,21-,22-,23-,24-/m0/s1 |
| InChIKey | MBEHNCHNSYACMW-AMDZRDIESA-N |
| XLogP | 4.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|