C17H18F3NO5S — CID 22817491
(2S)-1-(3-acetylsulfanylpropanoyl)-4-hydroxy-4-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid (PubChem CID 22817491) has the molecular formula C17H18F3NO5S and a molecular weight of 405.39 g/mol. Its IUPAC name is (2S)-1-(3-acetylsulfanylpropanoyl)-4-hydroxy-4-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-acetylsulfanylpropanoyl)-4-hydroxy-4-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22817491 |
| Molecular Formula | C17H18F3NO5S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (2S)-1-(3-acetylsulfanylpropanoyl)-4-hydroxy-4-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SCCC(=O)N1CC(O)(c2ccc(C(F)(F)F)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H18F3NO5S/c1-10(22)27-7-6-14(23)21-9-16(26,8-13(21)15(24)25)11-2-4-12(5-3-11)17(18,19)20/h2-5,13,26H,6-9H2,1H3,(H,24,25)/t13-,16?/m0/s1 |
| InChIKey | URXBLUMUBCDMFQ-KNVGNIICSA-N |
| XLogP | 2.25 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|