C12H10F4O2 — CID 127263565
3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid (PubChem CID 127263565) has the molecular formula C12H10F4O2 and a molecular weight of 262.20 g/mol. Its IUPAC name is 3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid.
| Compound Name | 3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 127263565 |
| Molecular Formula | C12H10F4O2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(F)(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C12H10F4O2/c13-11(5-7(6-11)10(17)18)8-1-3-9(4-2-8)12(14,15)16/h1-4,7H,5-6H2,(H,17,18) |
| InChIKey | VKLMSVIENNVIPW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |