C14H13F3O3 — CID 117194054
2-[4-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 117194054) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 117194054 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(C(F)(F)F)cc2)CC2CCC1O2 |
| InChI | InChI=1S/C14H13F3O3/c15-14(16,17)9-3-1-8(2-4-9)13(12(18)19)7-10-5-6-11(13)20-10/h1-4,10-11H,5-7H2,(H,18,19) |
| InChIKey | IWGHBQIKDSVERK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |