C27H42O3 — CID 22818350
(6R)-6-[(9S,10R,13R,14R,17R)-3,3-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-one (PubChem CID 22818350) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is (6R)-6-[(9S,10R,13R,14R,17R)-3,3-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-one.
| Compound Name | (6R)-6-[(9S,10R,13R,14R,17R)-3,3-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-one |
|---|---|
| PubChem CID | 22818350 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | (6R)-6-[(9S,10R,13R,14R,17R)-3,3-dihydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-one |
| SMILES | CC(C)C(=O)CC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4CC(O)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H42O3/c1-17(2)24(28)11-6-18(3)21-9-10-22-20-8-7-19-16-27(29,30)15-14-25(19,4)23(20)12-13-26(21,22)5/h7-8,17-18,21-23,29-30H,6,9-16H2,1-5H3/t18-,21-,22+,23+,25+,26-/m1/s1 |
| InChIKey | RSCJKZPBPYTLPF-UGJHKWMDSA-N |
| XLogP | 5.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|