C14H17NO5S — CID 22819370
(2S,4S)-4-(4-methoxyphenoxy)-1-(2-sulfanylacetyl)pyrrolidine-2-carboxylic acid (PubChem CID 22819370) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2S,4S)-4-(4-methoxyphenoxy)-1-(2-sulfanylacetyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(4-methoxyphenoxy)-1-(2-sulfanylacetyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22819370 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (2S,4S)-4-(4-methoxyphenoxy)-1-(2-sulfanylacetyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(O[C@H]2C[C@@H](C(=O)O)N(C(=O)CS)C2)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-19-9-2-4-10(5-3-9)20-11-6-12(14(17)18)15(7-11)13(16)8-21/h2-5,11-12,21H,6-8H2,1H3,(H,17,18)/t11-,12-/m0/s1 |
| InChIKey | PPPXLMNSWBPFSH-RYUDHWBXSA-N |
| XLogP | 1.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|