C22H21N3Na2O11S — CID 22819891
disodium;(6R,7S)-3-(acetyloxymethyl)-7-(2-amino-2-carboxyethoxy)-7-[(2-carboxylato-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22819891) has the molecular formula C22H21N3Na2O11S and a molecular weight of 581.47 g/mol. Its IUPAC name is disodium;(6R,7S)-3-(acetyloxymethyl)-7-(2-amino-2-carboxyethoxy)-7-[(2-carboxylato-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | disodium;(6R,7S)-3-(acetyloxymethyl)-7-(2-amino-2-carboxyethoxy)-7-[(2-carboxylato-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22819891 |
| Molecular Formula | C22H21N3Na2O11S |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | disodium;(6R,7S)-3-(acetyloxymethyl)-7-(2-amino-2-carboxyethoxy)-7-[(2-carboxylato-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)[O-])N2C(=O)[C@](NC(=O)C(C(=O)[O-])c3ccccc3)(OCC(N)C(=O)O)[C@H]2SC1.[Na+].[Na+] |
| InChI | InChI=1S/C22H23N3O11S.2Na/c1-10(26)35-7-12-9-37-21-22(36-8-13(23)17(28)29,20(34)25(21)15(12)19(32)33)24-16(27)14(18(30)31)11-5-3-2-4-6-11;;/h2-6,13-14,21H,7-9,23H2,1H3,(H,24,27)(H,28,29)(H,30,31)(H,32,33);;/q;2*+1/p-2/t13?,14?,21-,22+;;/m1../s1 |
| InChIKey | KWJIBDPSLDDGCX-LYXAJLMKSA-L |
| XLogP | -9.75 |
| TPSA | 228.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | -9.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|