C17H24N2O3 — CID 22822744
benzyl 2-[[(2R,3R)-2-(2-methylpropyl)-4-oxoazetidin-3-yl]amino]propanoate (PubChem CID 22822744) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzyl 2-[[(2R,3R)-2-(2-methylpropyl)-4-oxoazetidin-3-yl]amino]propanoate.
| Compound Name | benzyl 2-[[(2R,3R)-2-(2-methylpropyl)-4-oxoazetidin-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 22822744 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | benzyl 2-[[(2R,3R)-2-(2-methylpropyl)-4-oxoazetidin-3-yl]amino]propanoate |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H]1NC(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c1-11(2)9-14-15(16(20)19-14)18-12(3)17(21)22-10-13-7-5-4-6-8-13/h4-8,11-12,14-15,18H,9-10H2,1-3H3,(H,19,20)/t12?,14-,15-/m1/s1 |
| InChIKey | KGPFULGKNWIBQZ-JENMUQSASA-N |
| XLogP | 1.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |