C16H19N3O7 — CID 54333274
1-formamidoethyl [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate (PubChem CID 54333274) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-formamidoethyl [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate.
| Compound Name | 1-formamidoethyl [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 54333274 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-formamidoethyl [(2R,3R)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate |
| SMILES | CC(NC=O)OC(=O)OC[C@@H]1NC(=O)[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O7/c1-10(17-9-20)26-16(23)25-8-12-13(14(21)18-12)19-15(22)24-7-11-5-3-2-4-6-11/h2-6,9-10,12-13H,7-8H2,1H3,(H,17,20)(H,18,21)(H,19,22)/t10?,12-,13+/m0/s1 |
| InChIKey | SZVGEZQVBUTQDM-HEVMSJOKSA-N |
| XLogP | 0.03 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|