C13H15BrN2O4 — CID 15858810
benzyl N-[(2R,3S)-2-(2-bromoethoxy)-4-oxoazetidin-3-yl]carbamate (PubChem CID 15858810) has the molecular formula C13H15BrN2O4 and a molecular weight of 343.18 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-2-(2-bromoethoxy)-4-oxoazetidin-3-yl]carbamate.
| Compound Name | benzyl N-[(2R,3S)-2-(2-bromoethoxy)-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 15858810 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | benzyl N-[(2R,3S)-2-(2-bromoethoxy)-4-oxoazetidin-3-yl]carbamate |
| SMILES | O=C(N[C@@H]1C(=O)N[C@@H]1OCCBr)OCc1ccccc1 |
| InChI | InChI=1S/C13H15BrN2O4/c14-6-7-19-12-10(11(17)16-12)15-13(18)20-8-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2,(H,15,18)(H,16,17)/t10-,12-/m1/s1 |
| InChIKey | HFWGEXXQVPVKQU-ZYHUDNBSSA-N |
| XLogP | 1.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|