C35H34N2O6 — CID 177403390
benzyl N-[(3R,4S,5S,6E)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)piperidin-3-yl]carbamate (PubChem CID 177403390) has the molecular formula C35H34N2O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is benzyl N-[(3R,4S,5S,6E)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)piperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3R,4S,5S,6E)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 177403390 |
| Molecular Formula | C35H34N2O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | benzyl N-[(3R,4S,5S,6E)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)piperidin-3-yl]carbamate |
| SMILES | O=C(N[C@H]1C(=O)N/C(=C/OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C35H34N2O6/c38-34-31(37-35(39)43-24-29-19-11-4-12-20-29)33(42-23-28-17-9-3-10-18-28)32(41-22-27-15-7-2-8-16-27)30(36-34)25-40-21-26-13-5-1-6-14-26/h1-20,25,31-33H,21-24H2,(H,36,38)(H,37,39)/b30-25+/t31-,32+,33+/m1/s1 |
| InChIKey | ZLJXUOFIIDVFBL-TWYXZMDJSA-N |
| XLogP | 5.64 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|