C26H32N8O9 — CID 22828229
ethyl (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]oxolane-2-carboxylate (PubChem CID 22828229) has the molecular formula C26H32N8O9 and a molecular weight of 600.59 g/mol. Its IUPAC name is ethyl (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]oxolane-2-carboxylate.
| Compound Name | ethyl (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 22828229 |
| Molecular Formula | C26H32N8O9 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | ethyl (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]oxolane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1NC(=O)C(Cc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32N8O9/c1-5-41-24(37)19-16(18(35)23(42-19)33-12-30-17-20(27)28-11-29-21(17)33)32-22(36)15(31-25(38)43-26(2,3)4)10-13-6-8-14(9-7-13)34(39)40/h6-9,11-12,15-16,18-19,23,35H,5,10H2,1-4H3,(H,31,38)(H,32,36)(H2,27,28,29)/t15?,16-,18+,19-,23+/m0/s1 |
| InChIKey | CZNQMRZSUBEOQB-YATBOPJKSA-N |
| XLogP | 0.76 |
| TPSA | 235.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|