C26H32N2O2S — CID 2283173
(6S)-2-benzamido-6-tert-butyl-N,N-bis(prop-2-enyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2283173) has the molecular formula C26H32N2O2S and a molecular weight of 436.62 g/mol. Its IUPAC name is (6S)-2-benzamido-6-tert-butyl-N,N-bis(prop-2-enyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-benzamido-6-tert-butyl-N,N-bis(prop-2-enyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2283173 |
| Molecular Formula | C26H32N2O2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (6S)-2-benzamido-6-tert-butyl-N,N-bis(prop-2-enyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1c(NC(=O)c2ccccc2)sc2c1CC[C@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C26H32N2O2S/c1-6-15-28(16-7-2)25(30)22-20-14-13-19(26(3,4)5)17-21(20)31-24(22)27-23(29)18-11-9-8-10-12-18/h6-12,19H,1-2,13-17H2,3-5H3,(H,27,29)/t19-/m0/s1 |
| InChIKey | LXSMQPFOPBZPRT-IBGZPJMESA-N |
| XLogP | 5.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|