C24H30N2O2S — CID 5050961
6-tert-butyl-2-[(4-methylbenzoyl)amino]-N-prop-2-enyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5050961) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 6-tert-butyl-2-[(4-methylbenzoyl)amino]-N-prop-2-enyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[(4-methylbenzoyl)amino]-N-prop-2-enyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5050961 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 6-tert-butyl-2-[(4-methylbenzoyl)amino]-N-prop-2-enyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCNC(=O)c1c(NC(=O)c2ccc(C)cc2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C24H30N2O2S/c1-6-13-25-22(28)20-18-12-11-17(24(3,4)5)14-19(18)29-23(20)26-21(27)16-9-7-15(2)8-10-16/h6-10,17H,1,11-14H2,2-5H3,(H,25,28)(H,26,27) |
| InChIKey | JGURHIXIOOPQJM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|