C33H50O7 — CID 22832203
[(2R,3S,10R,13R,16R,17R)-2,16-diacetyloxy-3-hydroxy-10-methyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate (PubChem CID 22832203) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is [(2R,3S,10R,13R,16R,17R)-2,16-diacetyloxy-3-hydroxy-10-methyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate.
| Compound Name | [(2R,3S,10R,13R,16R,17R)-2,16-diacetyloxy-3-hydroxy-10-methyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate |
|---|---|
| PubChem CID | 22832203 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | [(2R,3S,10R,13R,16R,17R)-2,16-diacetyloxy-3-hydroxy-10-methyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CCC3C(CC=C4C[C@H](O)[C@H](OC(C)=O)C[C@@]43C)C1C[C@@H](OC(C)=O)[C@@H]2C(C)/C=C/CC(C)C |
| InChI | InChI=1S/C33H50O7/c1-19(2)9-8-10-20(3)31-29(39-22(5)35)16-27-25-12-11-24-15-28(37)30(40-23(6)36)17-32(24,7)26(25)13-14-33(27,31)18-38-21(4)34/h8,10-11,19-20,25-31,37H,9,12-18H2,1-7H3/b10-8+/t20?,25?,26?,27?,28-,29+,30+,31-,32-,33+/m0/s1 |
| InChIKey | POTGHKHPKJAJDX-KRQAFRQYSA-N |
| XLogP | 5.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|