C31H48O6 — CID 46865326
[(3S,9S,10R,13S,16S)-16-acetyloxy-17-[(2S,6R)-7-hydroxy-6-methyl-3-oxoheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 46865326) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is [(3S,9S,10R,13S,16S)-16-acetyloxy-17-[(2S,6R)-7-hydroxy-6-methyl-3-oxoheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,9S,10R,13S,16S)-16-acetyloxy-17-[(2S,6R)-7-hydroxy-6-methyl-3-oxoheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 46865326 |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | [(3S,9S,10R,13S,16S)-16-acetyloxy-17-[(2S,6R)-7-hydroxy-6-methyl-3-oxoheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C4C[C@H](OC(C)=O)C(C(C)C(=O)CC[C@@H](C)CO)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H48O6/c1-18(17-32)7-10-27(35)19(2)29-28(37-21(4)34)16-26-24-9-8-22-15-23(36-20(3)33)11-13-30(22,5)25(24)12-14-31(26,29)6/h8,18-19,23-26,28-29,32H,7,9-17H2,1-6H3/t18-,19?,23+,24?,25+,26?,28+,29?,30+,31+/m1/s1 |
| InChIKey | INUVWOFKWFJJFJ-ZJWUSXPFSA-N |
| XLogP | 5.65 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|